C25H28N2O3 — CID 10341185
methyl 4-(7,7,10,10-tetramethyl-4-oxo-3,5,8,9-tetrahydrobenzo[h][1,5]benzodiazepin-2-yl)benzoate (PubChem CID 10341185) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is methyl 4-(7,7,10,10-tetramethyl-4-oxo-3,5,8,9-tetrahydrobenzo[h][1,5]benzodiazepin-2-yl)benzoate.
| Compound Name | methyl 4-(7,7,10,10-tetramethyl-4-oxo-3,5,8,9-tetrahydrobenzo[h][1,5]benzodiazepin-2-yl)benzoate |
|---|---|
| PubChem CID | 10341185 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | methyl 4-(7,7,10,10-tetramethyl-4-oxo-3,5,8,9-tetrahydrobenzo[h][1,5]benzodiazepin-2-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2=Nc3cc4c(cc3NC(=O)C2)C(C)(C)CCC4(C)C)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-24(2)10-11-25(3,4)18-13-21-20(12-17(18)24)26-19(14-22(28)27-21)15-6-8-16(9-7-15)23(29)30-5/h6-9,12-13H,10-11,14H2,1-5H3,(H,27,28) |
| InChIKey | QMBJXRUDBSHGFL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |