C13H23N3O4 — CID 103412224
3-[3-(2-methoxyethoxy)propyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 103412224) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-[3-(2-methoxyethoxy)propyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[3-(2-methoxyethoxy)propyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 103412224 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-[3-(2-methoxyethoxy)propyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COCCOCCCN1C(=O)NC2(CCCNC2)C1=O |
| InChI | InChI=1S/C13H23N3O4/c1-19-8-9-20-7-3-6-16-11(17)13(15-12(16)18)4-2-5-14-10-13/h14H,2-10H2,1H3,(H,15,18) |
| InChIKey | QHIQLQMYLLIDME-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|