C16H26FNO2 — CID 103412646
N-ethyl-2-(2-fluorophenyl)-5-(2-methoxyethoxy)pentan-1-amine (PubChem CID 103412646) has the molecular formula C16H26FNO2 and a molecular weight of 283.39 g/mol. Its IUPAC name is N-ethyl-2-(2-fluorophenyl)-5-(2-methoxyethoxy)pentan-1-amine.
| Compound Name | N-ethyl-2-(2-fluorophenyl)-5-(2-methoxyethoxy)pentan-1-amine |
|---|---|
| PubChem CID | 103412646 |
| Molecular Formula | C16H26FNO2 |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | N-ethyl-2-(2-fluorophenyl)-5-(2-methoxyethoxy)pentan-1-amine |
| SMILES | CCNCC(CCCOCCOC)c1ccccc1F |
| InChI | InChI=1S/C16H26FNO2/c1-3-18-13-14(7-6-10-20-12-11-19-2)15-8-4-5-9-16(15)17/h4-5,8-9,14,18H,3,6-7,10-13H2,1-2H3 |
| InChIKey | CSHXXLWBUXAGMN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|