About N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide
N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide (PubChem CID 103413967) has the molecular formula C13H17N3O2S2
and a molecular weight of 311.43 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 103413967 |
| Molecular Formula | C13H17N3O2S2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide |
| SMILES | CCCN(c1ccc(N)cc1)S(=O)(=O)c1cnc(C)s1 |
| InChI | InChI=1S/C13H17N3O2S2/c1-3-8-16(12-6-4-11(14)5-7-12)20(17,18)13-9-15-10(2)19-13/h4-7,9H,3,8,14H2,1-2H3 |
| InChIKey | GDAHWPWKQDQRHG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide (CID 103413967) is N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide is CCCN(c1ccc(N)cc1)S(=O)(=O)c1cnc(C)s1.
What is the InChIKey of N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide?
The InChIKey is GDAHWPWKQDQRHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2S2/c1-3-8-16(12-6-4-11(14)5-7-12)20(17,18)13-9-15-10(2)19-13/h4-7,9H,3,8,14H2,1-2H3.
What are the key properties of N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide?
N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide has a molecular weight of 311.43 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminophenyl)-2-methyl-N-propyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 103413967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).