About 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid
4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid (PubChem CID 103414068) has the molecular formula C13H20N2O4S2
and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid |
| PubChem CID | 103414068 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(NS(=O)(=O)c2cnc(C)s2)(C(=O)O)CC1 |
| InChI | InChI=1S/C13H20N2O4S2/c1-3-10-4-6-13(7-5-10,12(16)17)15-21(18,19)11-8-14-9(2)20-11/h8,10,15H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | ZJTROYBLFBHGTF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid (CID 103414068) is 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid is CCC1CCC(NS(=O)(=O)c2cnc(C)s2)(C(=O)O)CC1.
What is the InChIKey of 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid?
The InChIKey is ZJTROYBLFBHGTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O4S2/c1-3-10-4-6-13(7-5-10,12(16)17)15-21(18,19)11-8-14-9(2)20-11/h8,10,15H,3-7H2,1-2H3,(H,16,17).
What are the key properties of 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid?
4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid has a molecular weight of 332.45 g/mol, XLogP of 2.15, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 103414068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).