About 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid
2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid (PubChem CID 103414080) has the molecular formula C10H16N2O4S2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid.
Molecular Properties
| Compound Name | 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid |
| PubChem CID | 103414080 |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid |
| SMILES | CCCC(C)(NS(=O)(=O)c1cnc(C)s1)C(=O)O |
| InChI | InChI=1S/C10H16N2O4S2/c1-4-5-10(3,9(13)14)12-18(15,16)8-6-11-7(2)17-8/h6,12H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | RJBZBXGRISPLTG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid?
The IUPAC name of 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid (CID 103414080) is 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid.
What is the SMILES notation for 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid?
The canonical SMILES for 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid is CCCC(C)(NS(=O)(=O)c1cnc(C)s1)C(=O)O.
What is the InChIKey of 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid?
The InChIKey is RJBZBXGRISPLTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O4S2/c1-4-5-10(3,9(13)14)12-18(15,16)8-6-11-7(2)17-8/h6,12H,4-5H2,1-3H3,(H,13,14).
What are the key properties of 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid?
2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid has a molecular weight of 292.38 g/mol, XLogP of 1.37, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]pentanoic acid is sourced from PubChem (CID 103414080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).