About 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid
2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid (PubChem CID 103414166) has the molecular formula C12H18N2O4S2
and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid |
| PubChem CID | 103414166 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ncc(S(=O)(=O)NC2(C(=O)O)CCCCC2C)s1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-8-5-3-4-6-12(8,11(15)16)14-20(17,18)10-7-13-9(2)19-10/h7-8,14H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | MSOSNSPHZORYGT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid?
The IUPAC name of 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid (CID 103414166) is 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid is Cc1ncc(S(=O)(=O)NC2(C(=O)O)CCCCC2C)s1.
What is the InChIKey of 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid?
The InChIKey is MSOSNSPHZORYGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4S2/c1-8-5-3-4-6-12(8,11(15)16)14-20(17,18)10-7-13-9(2)19-10/h7-8,14H,3-6H2,1-2H3,(H,15,16).
What are the key properties of 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid?
2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid has a molecular weight of 318.42 g/mol, XLogP of 1.76, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 103414166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).