C13H18Br2N2O — CID 103414484
1-(2,4-dibromo-5-methoxyphenyl)-N-ethylpyrrolidin-3-amine (PubChem CID 103414484) has the molecular formula C13H18Br2N2O and a molecular weight of 378.11 g/mol. Its IUPAC name is 1-(2,4-dibromo-5-methoxyphenyl)-N-ethylpyrrolidin-3-amine.
| Compound Name | 1-(2,4-dibromo-5-methoxyphenyl)-N-ethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 103414484 |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 1-(2,4-dibromo-5-methoxyphenyl)-N-ethylpyrrolidin-3-amine |
| SMILES | CCNC1CCN(c2cc(OC)c(Br)cc2Br)C1 |
| InChI | InChI=1S/C13H18Br2N2O/c1-3-16-9-4-5-17(8-9)12-7-13(18-2)11(15)6-10(12)14/h6-7,9,16H,3-5,8H2,1-2H3 |
| InChIKey | KYEJRIVQKOLETE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |