About 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide
4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide (PubChem CID 103414625) has the molecular formula C12H19N3O2S3
and a molecular weight of 333.50 g/mol. Its IUPAC name is 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide.
Molecular Properties
| Compound Name | 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide |
| PubChem CID | 103414625 |
| Molecular Formula | C12H19N3O2S3 |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide |
| SMILES | Cc1ncc(S(=O)(=O)NC2(C(N)=S)CCC(C)CC2)s1 |
| InChI | InChI=1S/C12H19N3O2S3/c1-8-3-5-12(6-4-8,11(13)18)15-20(16,17)10-7-14-9(2)19-10/h7-8,15H,3-6H2,1-2H3,(H2,13,18) |
| InChIKey | VJPBCZRHYCVTRJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide?
The IUPAC name of 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide (CID 103414625) is 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide.
What is the SMILES notation for 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide?
The canonical SMILES for 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide is Cc1ncc(S(=O)(=O)NC2(C(N)=S)CCC(C)CC2)s1.
What is the InChIKey of 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide?
The InChIKey is VJPBCZRHYCVTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2S3/c1-8-3-5-12(6-4-8,11(13)18)15-20(16,17)10-7-14-9(2)19-10/h7-8,15H,3-6H2,1-2H3,(H2,13,18).
What are the key properties of 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide?
4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide has a molecular weight of 333.50 g/mol, XLogP of 1.96, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-[(2-methyl-1,3-thiazol-5-yl)sulfonylamino]cyclohexane-1-carbothioamide is sourced from PubChem (CID 103414625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).