About N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide
N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103414854) has the molecular formula C13H22N2O3S2
and a molecular weight of 318.46 g/mol. Its IUPAC name is N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 103414854 |
| Molecular Formula | C13H22N2O3S2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NCC2(O)CCC(C)(C)CC2)s1 |
| InChI | InChI=1S/C13H22N2O3S2/c1-10-14-8-11(19-10)20(17,18)15-9-13(16)6-4-12(2,3)5-7-13/h8,15-16H,4-7,9H2,1-3H3 |
| InChIKey | BJPAFYGVFXKGJK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide (CID 103414854) is N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide is Cc1ncc(S(=O)(=O)NCC2(O)CCC(C)(C)CC2)s1.
What is the InChIKey of N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide?
The InChIKey is BJPAFYGVFXKGJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3S2/c1-10-14-8-11(19-10)20(17,18)15-9-13(16)6-4-12(2,3)5-7-13/h8,15-16H,4-7,9H2,1-3H3.
What are the key properties of N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide?
N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide has a molecular weight of 318.46 g/mol, XLogP of 2.06, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-hydroxy-4,4-dimethylcyclohexyl)methyl]-2-methyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 103414854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).