C13H12ClN3O2S2 — CID 103415602
N-[3-(3-aminoprop-1-ynyl)-4-chlorophenyl]-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103415602) has the molecular formula C13H12ClN3O2S2 and a molecular weight of 341.85 g/mol. Its IUPAC name is N-[3-(3-aminoprop-1-ynyl)-4-chlorophenyl]-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-[3-(3-aminoprop-1-ynyl)-4-chlorophenyl]-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103415602 |
| Molecular Formula | C13H12ClN3O2S2 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | N-[3-(3-aminoprop-1-ynyl)-4-chlorophenyl]-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2ccc(Cl)c(C#CCN)c2)s1 |
| InChI | InChI=1S/C13H12ClN3O2S2/c1-9-16-8-13(20-9)21(18,19)17-11-4-5-12(14)10(7-11)3-2-6-15/h4-5,7-8,17H,6,15H2,1H3 |
| InChIKey | JBHYNFIEJQFAHC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|