C20H25F2NO4S — CID 10341660
2-[4-[(2R)-2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]acetic acid (PubChem CID 10341660) has the molecular formula C20H25F2NO4S and a molecular weight of 413.49 g/mol. Its IUPAC name is 2-[4-[(2R)-2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]acetic acid.
| Compound Name | 2-[4-[(2R)-2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 10341660 |
| Molecular Formula | C20H25F2NO4S |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[4-[(2R)-2-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCCN1C(=O)CC[C@@H]1/C=C/C(O)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C20H25F2NO4S/c21-20(22,15-6-2-1-3-7-15)17(24)10-8-16-9-11-18(25)23(16)12-4-5-13-28-14-19(26)27/h1-3,6-8,10,16-17,24H,4-5,9,11-14H2,(H,26,27)/b10-8+/t16-,17?/m0/s1 |
| InChIKey | GHZZPQZXVRXOFS-FNPGKKEOSA-N |
| XLogP | 3.28 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|