C7H10F6IO3P — CID 10341696
1-diethoxyphosphoryl-1,1,2,2,3,3-hexafluoro-3-iodopropane (PubChem CID 10341696) has the molecular formula C7H10F6IO3P and a molecular weight of 414.02 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1,2,2,3,3-hexafluoro-3-iodopropane.
| Compound Name | 1-diethoxyphosphoryl-1,1,2,2,3,3-hexafluoro-3-iodopropane |
|---|---|
| PubChem CID | 10341696 |
| Molecular Formula | C7H10F6IO3P |
| Molecular Weight | 414.02 g/mol |
| Exact Mass | 413.93 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1,2,2,3,3-hexafluoro-3-iodopropane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C7H10F6IO3P/c1-3-16-18(15,17-4-2)7(12,13)5(8,9)6(10,11)14/h3-4H2,1-2H3 |
| InChIKey | OGJUPJLTSUQDMW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.02 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|