C11H15NO2S2 — CID 103417487
(3-amino-5-ethylsulfanyl-4-methoxythiophen-2-yl)-cyclopropylmethanone (PubChem CID 103417487) has the molecular formula C11H15NO2S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is (3-amino-5-ethylsulfanyl-4-methoxythiophen-2-yl)-cyclopropylmethanone.
| Compound Name | (3-amino-5-ethylsulfanyl-4-methoxythiophen-2-yl)-cyclopropylmethanone |
|---|---|
| PubChem CID | 103417487 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (3-amino-5-ethylsulfanyl-4-methoxythiophen-2-yl)-cyclopropylmethanone |
| SMILES | CCSc1sc(C(=O)C2CC2)c(N)c1OC |
| InChI | InChI=1S/C11H15NO2S2/c1-3-15-11-9(14-2)7(12)10(16-11)8(13)6-4-5-6/h6H,3-5,12H2,1-2H3 |
| InChIKey | KYCNBTFEHHBAGY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |