C15H27N3O2S — CID 103417899
3-amino-4-methoxy-5-[methyl(3-methylbutyl)amino]-N-propylthiophene-2-carboxamide (PubChem CID 103417899) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is 3-amino-4-methoxy-5-[methyl(3-methylbutyl)amino]-N-propylthiophene-2-carboxamide.
| Compound Name | 3-amino-4-methoxy-5-[methyl(3-methylbutyl)amino]-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103417899 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-amino-4-methoxy-5-[methyl(3-methylbutyl)amino]-N-propylthiophene-2-carboxamide |
| SMILES | CCCNC(=O)c1sc(N(C)CCC(C)C)c(OC)c1N |
| InChI | InChI=1S/C15H27N3O2S/c1-6-8-17-14(19)13-11(16)12(20-5)15(21-13)18(4)9-7-10(2)3/h10H,6-9,16H2,1-5H3,(H,17,19) |
| InChIKey | WENBUYRKNIWNOS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |