C27H44O3 — CID 10341876
methyl (5Z,8Z,10S,14Z)-11,12-dicyclopropyl-10-hydroxyicosa-5,8,14-trienoate (PubChem CID 10341876) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is methyl (5Z,8Z,10S,14Z)-11,12-dicyclopropyl-10-hydroxyicosa-5,8,14-trienoate.
| Compound Name | methyl (5Z,8Z,10S,14Z)-11,12-dicyclopropyl-10-hydroxyicosa-5,8,14-trienoate |
|---|---|
| PubChem CID | 10341876 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | methyl (5Z,8Z,10S,14Z)-11,12-dicyclopropyl-10-hydroxyicosa-5,8,14-trienoate |
| SMILES | CCCCC/C=C\CC(C1CC1)C(C1CC1)[C@@H](O)/C=C\C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C27H44O3/c1-3-4-5-6-9-12-15-24(22-18-19-22)27(23-20-21-23)25(28)16-13-10-7-8-11-14-17-26(29)30-2/h7-9,12-13,16,22-25,27-28H,3-6,10-11,14-15,17-21H2,1-2H3/b8-7-,12-9-,16-13-/t24?,25-,27?/m0/s1 |
| InChIKey | ODNVBPFEZJHAAU-OBNWJGEWSA-N |
| XLogP | 6.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|