About 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea
1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea (PubChem CID 10341898) has the molecular formula C25H21F2N3O
and a molecular weight of 417.46 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea.
Molecular Properties
| Compound Name | 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea |
| PubChem CID | 10341898 |
| Molecular Formula | C25H21F2N3O |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea |
| SMILES | Cc1cc(C)c2ncc(NC(=O)Nc3ccc(F)cc3F)c(-c3ccccc3C)c2c1 |
| InChI | InChI=1S/C25H21F2N3O/c1-14-10-16(3)24-19(11-14)23(18-7-5-4-6-15(18)2)22(13-28-24)30-25(31)29-21-9-8-17(26)12-20(21)27/h4-13H,1-3H3,(H2,29,30,31) |
| InChIKey | UESRUJSKPQNTAE-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea?
The IUPAC name of 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea (CID 10341898) is 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea.
What is the SMILES notation for 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea?
The canonical SMILES for 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea is Cc1cc(C)c2ncc(NC(=O)Nc3ccc(F)cc3F)c(-c3ccccc3C)c2c1.
What is the InChIKey of 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea?
The InChIKey is UESRUJSKPQNTAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21F2N3O/c1-14-10-16(3)24-19(11-14)23(18-7-5-4-6-15(18)2)22(13-28-24)30-25(31)29-21-9-8-17(26)12-20(21)27/h4-13H,1-3H3,(H2,29,30,31).
What are the key properties of 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea?
1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea has a molecular weight of 417.46 g/mol, XLogP of 6.75, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorophenyl)-3-[6,8-dimethyl-4-(2-methylphenyl)quinolin-3-yl]urea is sourced from PubChem (CID 10341898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).