C27H31NO3 — CID 10341919
(5S)-10-methoxy-2,2,4-trimethyl-5-[(1R)-3-methylcyclohex-2-en-1-yl]-1,5-dihydrochromeno[3,4-f]quinolin-9-ol (PubChem CID 10341919) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is (5S)-10-methoxy-2,2,4-trimethyl-5-[(1R)-3-methylcyclohex-2-en-1-yl]-1,5-dihydrochromeno[3,4-f]quinolin-9-ol.
| Compound Name | (5S)-10-methoxy-2,2,4-trimethyl-5-[(1R)-3-methylcyclohex-2-en-1-yl]-1,5-dihydrochromeno[3,4-f]quinolin-9-ol |
|---|---|
| PubChem CID | 10341919 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (5S)-10-methoxy-2,2,4-trimethyl-5-[(1R)-3-methylcyclohex-2-en-1-yl]-1,5-dihydrochromeno[3,4-f]quinolin-9-ol |
| SMILES | COc1c(O)ccc2c1-c1ccc3c(c1[C@H]([C@H]1C=C(C)CCC1)O2)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C27H31NO3/c1-15-7-6-8-17(13-15)25-24-18(23-21(31-25)12-11-20(29)26(23)30-5)9-10-19-22(24)16(2)14-27(3,4)28-19/h9-14,17,25,28-29H,6-8H2,1-5H3/t17-,25+/m1/s1 |
| InChIKey | AWORLHRQSDNJDQ-NSYGIPOTSA-N |
| XLogP | 6.86 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|