C16H25N3OS — CID 103419645
3-amino-5-(azepan-1-yl)-4-cyclopropyl-N-ethylthiophene-2-carboxamide (PubChem CID 103419645) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is 3-amino-5-(azepan-1-yl)-4-cyclopropyl-N-ethylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(azepan-1-yl)-4-cyclopropyl-N-ethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103419645 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3-amino-5-(azepan-1-yl)-4-cyclopropyl-N-ethylthiophene-2-carboxamide |
| SMILES | CCNC(=O)c1sc(N2CCCCCC2)c(C2CC2)c1N |
| InChI | InChI=1S/C16H25N3OS/c1-2-18-15(20)14-13(17)12(11-7-8-11)16(21-14)19-9-5-3-4-6-10-19/h11H,2-10,17H2,1H3,(H,18,20) |
| InChIKey | HTMQJZZPBTVKOZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |