C11H17N3O3S — CID 103420870
methyl 3-amino-5-[ethyl(methyl)amino]-4-(methylcarbamoyl)thiophene-2-carboxylate (PubChem CID 103420870) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is methyl 3-amino-5-[ethyl(methyl)amino]-4-(methylcarbamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-5-[ethyl(methyl)amino]-4-(methylcarbamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103420870 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methyl 3-amino-5-[ethyl(methyl)amino]-4-(methylcarbamoyl)thiophene-2-carboxylate |
| SMILES | CCN(C)c1sc(C(=O)OC)c(N)c1C(=O)NC |
| InChI | InChI=1S/C11H17N3O3S/c1-5-14(3)10-6(9(15)13-2)7(12)8(18-10)11(16)17-4/h5,12H2,1-4H3,(H,13,15) |
| InChIKey | IBAXYMZJPLOGPS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |