C14H22N2OS — CID 103420898
1-[3-amino-4-cyclopropyl-5-[ethyl(methyl)amino]thiophen-2-yl]-2-methylpropan-1-one (PubChem CID 103420898) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 1-[3-amino-4-cyclopropyl-5-[ethyl(methyl)amino]thiophen-2-yl]-2-methylpropan-1-one.
| Compound Name | 1-[3-amino-4-cyclopropyl-5-[ethyl(methyl)amino]thiophen-2-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 103420898 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[3-amino-4-cyclopropyl-5-[ethyl(methyl)amino]thiophen-2-yl]-2-methylpropan-1-one |
| SMILES | CCN(C)c1sc(C(=O)C(C)C)c(N)c1C1CC1 |
| InChI | InChI=1S/C14H22N2OS/c1-5-16(4)14-10(9-6-7-9)11(15)13(18-14)12(17)8(2)3/h8-9H,5-7,15H2,1-4H3 |
| InChIKey | LXLCRAIUMKSUDP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |