C16H26N2O11 — CID 10342169
trans-(9S,20S)-9,20-bis(hydroxymethyl)-1,4,7,13,16-pentaoxa-10,19-diazacyclohenicosane-8,11,18,21-tetrone (PubChem CID 10342169) has the molecular formula C16H26N2O11 and a molecular weight of 422.39 g/mol. Its IUPAC name is trans-(9S,20S)-9,20-bis(hydroxymethyl)-1,4,7,13,16-pentaoxa-10,19-diazacyclohenicosane-8,11,18,21-tetrone.
| Compound Name | trans-(9S,20S)-9,20-bis(hydroxymethyl)-1,4,7,13,16-pentaoxa-10,19-diazacyclohenicosane-8,11,18,21-tetrone |
|---|---|
| PubChem CID | 10342169 |
| Molecular Formula | C16H26N2O11 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | trans-(9S,20S)-9,20-bis(hydroxymethyl)-1,4,7,13,16-pentaoxa-10,19-diazacyclohenicosane-8,11,18,21-tetrone |
| SMILES | O=C1COCCOCC(=O)N[C@@H](CO)C(=O)OCCOCCOC(=O)[C@H](CO)N1 |
| InChI | InChI=1S/C16H26N2O11/c19-7-11-15(23)28-5-3-25-4-6-29-16(24)12(8-20)18-14(22)10-27-2-1-26-9-13(21)17-11/h11-12,19-20H,1-10H2,(H,17,21)(H,18,22)/t11-,12-/m0/s1 |
| InChIKey | JRRFTLWGMZDBPV-RYUDHWBXSA-N |
| XLogP | -3.91 |
| TPSA | 178.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |