About methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate
methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate (PubChem CID 103421714) has the molecular formula C14H21N3O3S
and a molecular weight of 311.41 g/mol. Its IUPAC name is methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate |
| PubChem CID | 103421714 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(N2CCC(C)(C)CC2)sc(C(N)=O)c1N |
| InChI | InChI=1S/C14H21N3O3S/c1-14(2)4-6-17(7-5-14)12-8(13(19)20-3)9(15)10(21-12)11(16)18/h4-7,15H2,1-3H3,(H2,16,18) |
| InChIKey | HMVNAGZQOCQFRF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate?
The IUPAC name of methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate (CID 103421714) is methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate.
What is the SMILES notation for methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate?
The canonical SMILES for methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate is COC(=O)c1c(N2CCC(C)(C)CC2)sc(C(N)=O)c1N.
What is the InChIKey of methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate?
The InChIKey is HMVNAGZQOCQFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3S/c1-14(2)4-6-17(7-5-14)12-8(13(19)20-3)9(15)10(21-12)11(16)18/h4-7,15H2,1-3H3,(H2,16,18).
What are the key properties of methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate?
methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate has a molecular weight of 311.41 g/mol, XLogP of 1.84, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-5-carbamoyl-2-(4,4-dimethylpiperidin-1-yl)thiophene-3-carboxylate is sourced from PubChem (CID 103421714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).