C16H26N2O2S — CID 103422119
1-[3-amino-5-[cyclopentylmethyl(methyl)amino]-4-propan-2-yloxythiophen-2-yl]ethanone (PubChem CID 103422119) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 1-[3-amino-5-[cyclopentylmethyl(methyl)amino]-4-propan-2-yloxythiophen-2-yl]ethanone.
| Compound Name | 1-[3-amino-5-[cyclopentylmethyl(methyl)amino]-4-propan-2-yloxythiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 103422119 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[3-amino-5-[cyclopentylmethyl(methyl)amino]-4-propan-2-yloxythiophen-2-yl]ethanone |
| SMILES | CC(=O)c1sc(N(C)CC2CCCC2)c(OC(C)C)c1N |
| InChI | InChI=1S/C16H26N2O2S/c1-10(2)20-14-13(17)15(11(3)19)21-16(14)18(4)9-12-7-5-6-8-12/h10,12H,5-9,17H2,1-4H3 |
| InChIKey | GRQHGMLKLZPXRG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |