C25H27F2N3O — CID 10342243
2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridin-3-ol (PubChem CID 10342243) has the molecular formula C25H27F2N3O and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridin-3-ol.
| Compound Name | 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 10342243 |
| Molecular Formula | C25H27F2N3O |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 2-[4-[4,4-bis(4-fluorophenyl)butyl]piperazin-1-yl]pyridin-3-ol |
| SMILES | Oc1cccnc1N1CCN(CCCC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H27F2N3O/c26-21-9-5-19(6-10-21)23(20-7-11-22(27)12-8-20)3-2-14-29-15-17-30(18-16-29)25-24(31)4-1-13-28-25/h1,4-13,23,31H,2-3,14-18H2 |
| InChIKey | IIGSJTDZTYNWMI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |