C20H14ClF4N3O — CID 10342262
6-(3-chloroanilino)-N-[(4-fluorophenyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 10342262) has the molecular formula C20H14ClF4N3O and a molecular weight of 423.80 g/mol. Its IUPAC name is 6-(3-chloroanilino)-N-[(4-fluorophenyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 6-(3-chloroanilino)-N-[(4-fluorophenyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10342262 |
| Molecular Formula | C20H14ClF4N3O |
| Molecular Weight | 423.80 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 6-(3-chloroanilino)-N-[(4-fluorophenyl)methyl]-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1cnc(Nc2cccc(Cl)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H14ClF4N3O/c21-13-2-1-3-15(8-13)28-18-9-17(20(23,24)25)16(11-26-18)19(29)27-10-12-4-6-14(22)7-5-12/h1-9,11H,10H2,(H,26,28)(H,27,29) |
| InChIKey | PXBAWBJBSAXHLC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.80 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |