C13H22N4O3S — CID 103423352
3-amino-5-(2-methoxyethylamino)-4-N-methyl-2-N-propylthiophene-2,4-dicarboxamide (PubChem CID 103423352) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-amino-5-(2-methoxyethylamino)-4-N-methyl-2-N-propylthiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-5-(2-methoxyethylamino)-4-N-methyl-2-N-propylthiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 103423352 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-amino-5-(2-methoxyethylamino)-4-N-methyl-2-N-propylthiophene-2,4-dicarboxamide |
| SMILES | CCCNC(=O)c1sc(NCCOC)c(C(=O)NC)c1N |
| InChI | InChI=1S/C13H22N4O3S/c1-4-5-16-12(19)10-9(14)8(11(18)15-2)13(21-10)17-6-7-20-3/h17H,4-7,14H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | MXVPTLSAGKYZLB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|