C12H19N3O3S — CID 103423556
ethyl 4-amino-2-(butan-2-ylamino)-5-carbamoylthiophene-3-carboxylate (PubChem CID 103423556) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is ethyl 4-amino-2-(butan-2-ylamino)-5-carbamoylthiophene-3-carboxylate.
| Compound Name | ethyl 4-amino-2-(butan-2-ylamino)-5-carbamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 103423556 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | ethyl 4-amino-2-(butan-2-ylamino)-5-carbamoylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(C)CC)sc(C(N)=O)c1N |
| InChI | InChI=1S/C12H19N3O3S/c1-4-6(3)15-11-7(12(17)18-5-2)8(13)9(19-11)10(14)16/h6,15H,4-5,13H2,1-3H3,(H2,14,16) |
| InChIKey | PNNGIKTWCYBCTI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |