C15H16FN3OS — CID 103425991
3-amino-5-[(4-fluorophenyl)methylamino]-4-propan-2-yloxythiophene-2-carbonitrile (PubChem CID 103425991) has the molecular formula C15H16FN3OS and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-amino-5-[(4-fluorophenyl)methylamino]-4-propan-2-yloxythiophene-2-carbonitrile.
| Compound Name | 3-amino-5-[(4-fluorophenyl)methylamino]-4-propan-2-yloxythiophene-2-carbonitrile |
|---|---|
| PubChem CID | 103425991 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-amino-5-[(4-fluorophenyl)methylamino]-4-propan-2-yloxythiophene-2-carbonitrile |
| SMILES | CC(C)Oc1c(NCc2ccc(F)cc2)sc(C#N)c1N |
| InChI | InChI=1S/C15H16FN3OS/c1-9(2)20-14-13(18)12(7-17)21-15(14)19-8-10-3-5-11(16)6-4-10/h3-6,9,19H,8,18H2,1-2H3 |
| InChIKey | UUMXRDTUDROPDH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |