C30H39NO — CID 10342621
(1S,4aS,10aR)-1,4a-dimethyl-N-[(1-phenylcyclohexyl)methyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide (PubChem CID 10342621) has the molecular formula C30H39NO and a molecular weight of 429.65 g/mol. Its IUPAC name is (1S,4aS,10aR)-1,4a-dimethyl-N-[(1-phenylcyclohexyl)methyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide.
| Compound Name | (1S,4aS,10aR)-1,4a-dimethyl-N-[(1-phenylcyclohexyl)methyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
|---|---|
| PubChem CID | 10342621 |
| Molecular Formula | C30H39NO |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | (1S,4aS,10aR)-1,4a-dimethyl-N-[(1-phenylcyclohexyl)methyl]-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxamide |
| SMILES | C[C@]1(C(=O)NCC2(c3ccccc3)CCCCC2)CCC[C@]2(C)c3ccccc3CC[C@@H]12 |
| InChI | InChI=1S/C30H39NO/c1-28-18-11-19-29(2,26(28)17-16-23-12-7-8-15-25(23)28)27(32)31-22-30(20-9-4-10-21-30)24-13-5-3-6-14-24/h3,5-8,12-15,26H,4,9-11,16-22H2,1-2H3,(H,31,32)/t26-,28-,29+/m1/s1 |
| InChIKey | PXRKUDZYCJZQBB-CMYDWJSCSA-N |
| XLogP | 6.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |