About 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine
1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine (PubChem CID 10342634) has the molecular formula C22H25Cl2N5
and a molecular weight of 430.38 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine.
Molecular Properties
| Compound Name | 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine |
| PubChem CID | 10342634 |
| Molecular Formula | C22H25Cl2N5 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine |
| SMILES | N/C(=N\CCCc1cnc[nH]1)NCCC(c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2N5/c23-20-9-8-17(13-21(20)24)19(16-5-2-1-3-6-16)10-12-28-22(25)27-11-4-7-18-14-26-15-29-18/h1-3,5-6,8-9,13-15,19H,4,7,10-12H2,(H,26,29)(H3,25,27,28) |
| InChIKey | VZJQWRAJEFEHEY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine?
The IUPAC name of 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine (CID 10342634) is 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine.
What is the SMILES notation for 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine?
The canonical SMILES for 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine is N/C(=N\CCCc1cnc[nH]1)NCCC(c1ccccc1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine?
The InChIKey is VZJQWRAJEFEHEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25Cl2N5/c23-20-9-8-17(13-21(20)24)19(16-5-2-1-3-6-16)10-12-28-22(25)27-11-4-7-18-14-26-15-29-18/h1-3,5-6,8-9,13-15,19H,4,7,10-12H2,(H,26,29)(H3,25,27,28).
What are the key properties of 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine?
1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine has a molecular weight of 430.38 g/mol, XLogP of 4.78, 9 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,4-dichlorophenyl)-3-phenylpropyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine is sourced from PubChem (CID 10342634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).