C24H32O7 — CID 10342765
methyl (1R,2S,3R,6R,8S,9R,13S,14R,17R)-3-acetyloxy-4-methoxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadeca-10,15-diene-17-carboxylate (PubChem CID 10342765) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is methyl (1R,2S,3R,6R,8S,9R,13S,14R,17R)-3-acetyloxy-4-methoxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadeca-10,15-diene-17-carboxylate.
| Compound Name | methyl (1R,2S,3R,6R,8S,9R,13S,14R,17R)-3-acetyloxy-4-methoxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadeca-10,15-diene-17-carboxylate |
|---|---|
| PubChem CID | 10342765 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | methyl (1R,2S,3R,6R,8S,9R,13S,14R,17R)-3-acetyloxy-4-methoxy-9,13-dimethyl-5,18-dioxapentacyclo[12.5.0.01,6.02,17.08,13]nonadeca-10,15-diene-17-carboxylate |
| SMILES | COC(=O)[C@@]12C=C[C@@H]3[C@@]4(C)CC=C[C@@H](C)[C@@H]4C[C@H]4OC(OC)[C@H](OC(C)=O)[C@@H]1[C@@]34CO2 |
| InChI | InChI=1S/C24H32O7/c1-13-7-6-9-22(3)15(13)11-17-23-12-29-24(21(26)28-5,10-8-16(22)23)19(23)18(30-14(2)25)20(27-4)31-17/h6-8,10,13,15-20H,9,11-12H2,1-5H3/t13-,15+,16-,17-,18-,19-,20?,22+,23+,24-/m1/s1 |
| InChIKey | WVTZHTBADUDLIA-NNSBQSCDSA-N |
| XLogP | 2.64 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|