C19H18Cl2N6O2 — CID 10342809
5-[4-[(3,4-dichlorophenyl)methylamino]-3-nitrophenyl]-6-ethylpyrimidine-2,4-diamine (PubChem CID 10342809) has the molecular formula C19H18Cl2N6O2 and a molecular weight of 433.30 g/mol. Its IUPAC name is 5-[4-[(3,4-dichlorophenyl)methylamino]-3-nitrophenyl]-6-ethylpyrimidine-2,4-diamine.
| Compound Name | 5-[4-[(3,4-dichlorophenyl)methylamino]-3-nitrophenyl]-6-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10342809 |
| Molecular Formula | C19H18Cl2N6O2 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 5-[4-[(3,4-dichlorophenyl)methylamino]-3-nitrophenyl]-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(NCc2ccc(Cl)c(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18Cl2N6O2/c1-2-14-17(18(22)26-19(23)25-14)11-4-6-15(16(8-11)27(28)29)24-9-10-3-5-12(20)13(21)7-10/h3-8,24H,2,9H2,1H3,(H4,22,23,25,26) |
| InChIKey | PHSFDXSFHALXMN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|