C16H20Cl2N2O — CID 103428431
2-[(4,6-dichloroindol-1-yl)methyl]-4-propan-2-ylmorpholine (PubChem CID 103428431) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.26 g/mol. Its IUPAC name is 2-[(4,6-dichloroindol-1-yl)methyl]-4-propan-2-ylmorpholine.
| Compound Name | 2-[(4,6-dichloroindol-1-yl)methyl]-4-propan-2-ylmorpholine |
|---|---|
| PubChem CID | 103428431 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-[(4,6-dichloroindol-1-yl)methyl]-4-propan-2-ylmorpholine |
| SMILES | CC(C)N1CCOC(Cn2ccc3c(Cl)cc(Cl)cc32)C1 |
| InChI | InChI=1S/C16H20Cl2N2O/c1-11(2)19-5-6-21-13(9-19)10-20-4-3-14-15(18)7-12(17)8-16(14)20/h3-4,7-8,11,13H,5-6,9-10H2,1-2H3 |
| InChIKey | DCMFDNZIDBBCPY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |