C15H20N2O3 — CID 103428976
2-(3-aminopiperidine-1-carbonyl)-3,6-dimethylbenzoic acid (PubChem CID 103428976) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-(3-aminopiperidine-1-carbonyl)-3,6-dimethylbenzoic acid.
| Compound Name | 2-(3-aminopiperidine-1-carbonyl)-3,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 103428976 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-(3-aminopiperidine-1-carbonyl)-3,6-dimethylbenzoic acid |
| SMILES | Cc1ccc(C)c(C(=O)N2CCCC(N)C2)c1C(=O)O |
| InChI | InChI=1S/C15H20N2O3/c1-9-5-6-10(2)13(15(19)20)12(9)14(18)17-7-3-4-11(16)8-17/h5-6,11H,3-4,7-8,16H2,1-2H3,(H,19,20) |
| InChIKey | QYTLBQKYHRYLKW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |