About 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide
2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide (PubChem CID 103429649) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide.
Molecular Properties
| Compound Name | 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide |
| PubChem CID | 103429649 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide |
| SMILES | CCCNC(=O)CN(C)C(=O)C(C)(C)O |
| InChI | InChI=1S/C10H20N2O3/c1-5-6-11-8(13)7-12(4)9(14)10(2,3)15/h15H,5-7H2,1-4H3,(H,11,13) |
| InChIKey | QFBMPVCMIUJBQD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide?
The IUPAC name of 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide (CID 103429649) is 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide.
What is the SMILES notation for 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide?
The canonical SMILES for 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide is CCCNC(=O)CN(C)C(=O)C(C)(C)O.
What is the InChIKey of 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide?
The InChIKey is QFBMPVCMIUJBQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-5-6-11-8(13)7-12(4)9(14)10(2,3)15/h15H,5-7H2,1-4H3,(H,11,13).
What are the key properties of 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide?
2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide has a molecular weight of 216.28 g/mol, XLogP of -0.26, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N,2-dimethyl-N-[2-oxo-2-(propylamino)ethyl]propanamide is sourced from PubChem (CID 103429649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).