C12H23NO2 — CID 103429662
N-(4-ethylcyclohexyl)-2-hydroxy-2-methylpropanamide (PubChem CID 103429662) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-2-hydroxy-2-methylpropanamide.
| Compound Name | N-(4-ethylcyclohexyl)-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 103429662 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-(4-ethylcyclohexyl)-2-hydroxy-2-methylpropanamide |
| SMILES | CCC1CCC(NC(=O)C(C)(C)O)CC1 |
| InChI | InChI=1S/C12H23NO2/c1-4-9-5-7-10(8-6-9)13-11(14)12(2,3)15/h9-10,15H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | LLUJRMTXBKPZGC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |