C12H23NO3 — CID 103429770
N-(1-cyclopropylethyl)-2-hydroxy-N-(2-methoxyethyl)-2-methylpropanamide (PubChem CID 103429770) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-2-hydroxy-N-(2-methoxyethyl)-2-methylpropanamide.
| Compound Name | N-(1-cyclopropylethyl)-2-hydroxy-N-(2-methoxyethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 103429770 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | N-(1-cyclopropylethyl)-2-hydroxy-N-(2-methoxyethyl)-2-methylpropanamide |
| SMILES | COCCN(C(=O)C(C)(C)O)C(C)C1CC1 |
| InChI | InChI=1S/C12H23NO3/c1-9(10-5-6-10)13(7-8-16-4)11(14)12(2,3)15/h9-10,15H,5-8H2,1-4H3 |
| InChIKey | GBMUNWIBXNHGFA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |