About 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione
2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione (PubChem CID 103430970) has the molecular formula C14H14N4O2
and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione |
| PubChem CID | 103430970 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione |
| SMILES | Cc1ccc(C)c2c1C(=O)N(Cc1cn[nH]c1N)C2=O |
| InChI | InChI=1S/C14H14N4O2/c1-7-3-4-8(2)11-10(7)13(19)18(14(11)20)6-9-5-16-17-12(9)15/h3-5H,6H2,1-2H3,(H3,15,16,17) |
| InChIKey | VHMJCAQKBOURPD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione?
The IUPAC name of 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione (CID 103430970) is 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione.
What is the SMILES notation for 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione?
The canonical SMILES for 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione is Cc1ccc(C)c2c1C(=O)N(Cc1cn[nH]c1N)C2=O.
What is the InChIKey of 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione?
The InChIKey is VHMJCAQKBOURPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N4O2/c1-7-3-4-8(2)11-10(7)13(19)18(14(11)20)6-9-5-16-17-12(9)15/h3-5H,6H2,1-2H3,(H3,15,16,17).
What are the key properties of 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione?
2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione has a molecular weight of 270.29 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-1H-pyrazol-4-yl)methyl]-4,7-dimethylisoindole-1,3-dione is sourced from PubChem (CID 103430970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).