C14H15FN2O — CID 103431425
(1S)-1-[2-[(2-fluorophenyl)methyl]-4-methylpyrimidin-5-yl]ethanol (PubChem CID 103431425) has the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. Its IUPAC name is (1S)-1-[2-[(2-fluorophenyl)methyl]-4-methylpyrimidin-5-yl]ethanol.
| Compound Name | (1S)-1-[2-[(2-fluorophenyl)methyl]-4-methylpyrimidin-5-yl]ethanol |
|---|---|
| PubChem CID | 103431425 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (1S)-1-[2-[(2-fluorophenyl)methyl]-4-methylpyrimidin-5-yl]ethanol |
| SMILES | Cc1nc(Cc2ccccc2F)ncc1[C@H](C)O |
| InChI | InChI=1S/C14H15FN2O/c1-9-12(10(2)18)8-16-14(17-9)7-11-5-3-4-6-13(11)15/h3-6,8,10,18H,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | XHKXDIORAGEIJD-JTQLQIEISA-N |
| XLogP | 2.57 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |