C14H21N3 — CID 103431749
(1R)-1-[2-(2-bicyclo[2.2.1]heptanyl)-4-methylpyrimidin-5-yl]ethanamine (PubChem CID 103431749) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (1R)-1-[2-(2-bicyclo[2.2.1]heptanyl)-4-methylpyrimidin-5-yl]ethanamine.
| Compound Name | (1R)-1-[2-(2-bicyclo[2.2.1]heptanyl)-4-methylpyrimidin-5-yl]ethanamine |
|---|---|
| PubChem CID | 103431749 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (1R)-1-[2-(2-bicyclo[2.2.1]heptanyl)-4-methylpyrimidin-5-yl]ethanamine |
| SMILES | Cc1nc(C2CC3CCC2C3)ncc1[C@@H](C)N |
| InChI | InChI=1S/C14H21N3/c1-8(15)13-7-16-14(17-9(13)2)12-6-10-3-4-11(12)5-10/h7-8,10-12H,3-6,15H2,1-2H3/t8-,10?,11?,12?/m1/s1 |
| InChIKey | XHIQYUPWFOAFEH-HBCVRQPNSA-N |
| XLogP | 2.71 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |