C28H24O5 — CID 10343180
(4S,4'aS,5S)-4,5-dibenzylspiro[1,3-dioxolane-2,3'-4,4a-dihydropyrano[4,3-b]chromene]-10'-one (PubChem CID 10343180) has the molecular formula C28H24O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is (4S,4'aS,5S)-4,5-dibenzylspiro[1,3-dioxolane-2,3'-4,4a-dihydropyrano[4,3-b]chromene]-10'-one.
| Compound Name | (4S,4'aS,5S)-4,5-dibenzylspiro[1,3-dioxolane-2,3'-4,4a-dihydropyrano[4,3-b]chromene]-10'-one |
|---|---|
| PubChem CID | 10343180 |
| Molecular Formula | C28H24O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (4S,4'aS,5S)-4,5-dibenzylspiro[1,3-dioxolane-2,3'-4,4a-dihydropyrano[4,3-b]chromene]-10'-one |
| SMILES | O=C1C2=COC3(C[C@@H]2Oc2ccccc21)O[C@@H](Cc1ccccc1)[C@H](Cc1ccccc1)O3 |
| InChI | InChI=1S/C28H24O5/c29-27-21-13-7-8-14-23(21)31-26-17-28(30-18-22(26)27)32-24(15-19-9-3-1-4-10-19)25(33-28)16-20-11-5-2-6-12-20/h1-14,18,24-26H,15-17H2/t24-,25-,26-/m0/s1 |
| InChIKey | RHFABTQKXCNJGY-GSDHBNRESA-N |
| XLogP | 4.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |