C15H14BrNO3 — CID 103432348
1-[(2-bromo-4-nitrophenyl)methoxy]-2,3-dimethylbenzene (PubChem CID 103432348) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is 1-[(2-bromo-4-nitrophenyl)methoxy]-2,3-dimethylbenzene.
| Compound Name | 1-[(2-bromo-4-nitrophenyl)methoxy]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 103432348 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 1-[(2-bromo-4-nitrophenyl)methoxy]-2,3-dimethylbenzene |
| SMILES | Cc1cccc(OCc2ccc([N+](=O)[O-])cc2Br)c1C |
| InChI | InChI=1S/C15H14BrNO3/c1-10-4-3-5-15(11(10)2)20-9-12-6-7-13(17(18)19)8-14(12)16/h3-8H,9H2,1-2H3 |
| InChIKey | USWNFPXGJNROSX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|