About (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol
(2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol (PubChem CID 103432519) has the molecular formula C18H22O3
and a molecular weight of 286.37 g/mol. Its IUPAC name is (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol.
Molecular Properties
| Compound Name | (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol |
| PubChem CID | 103432519 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol |
| SMILES | COc1c(C(O)c2ccc(C3CC3C)o2)ccc(C)c1C |
| InChI | InChI=1S/C18H22O3/c1-10-5-6-13(18(20-4)12(10)3)17(19)16-8-7-15(21-16)14-9-11(14)2/h5-8,11,14,17,19H,9H2,1-4H3 |
| InChIKey | HUKGWPFXAXKUSG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol?
The IUPAC name of (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol (CID 103432519) is (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol.
What is the SMILES notation for (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol?
The canonical SMILES for (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol is COc1c(C(O)c2ccc(C3CC3C)o2)ccc(C)c1C.
What is the InChIKey of (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol?
The InChIKey is HUKGWPFXAXKUSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O3/c1-10-5-6-13(18(20-4)12(10)3)17(19)16-8-7-15(21-16)14-9-11(14)2/h5-8,11,14,17,19H,9H2,1-4H3.
What are the key properties of (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol?
(2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol has a molecular weight of 286.37 g/mol, XLogP of 4.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-3,4-dimethylphenyl)-[5-(2-methylcyclopropyl)furan-2-yl]methanol is sourced from PubChem (CID 103432519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).