C14H23NO — CID 103433382
1-(2-methoxy-3,4-dimethylphenyl)-N-methylbutan-1-amine (PubChem CID 103433382) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(2-methoxy-3,4-dimethylphenyl)-N-methylbutan-1-amine.
| Compound Name | 1-(2-methoxy-3,4-dimethylphenyl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 103433382 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(2-methoxy-3,4-dimethylphenyl)-N-methylbutan-1-amine |
| SMILES | CCCC(NC)c1ccc(C)c(C)c1OC |
| InChI | InChI=1S/C14H23NO/c1-6-7-13(15-4)12-9-8-10(2)11(3)14(12)16-5/h8-9,13,15H,6-7H2,1-5H3 |
| InChIKey | RRLJDCHYQBRVFZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |