C20H30FN3O5S — CID 10343370
4-[4-(5-butyl-2-pyridinyl)-4-fluoropiperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 10343370) has the molecular formula C20H30FN3O5S and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-[4-(5-butyl-2-pyridinyl)-4-fluoropiperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-(5-butyl-2-pyridinyl)-4-fluoropiperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 10343370 |
| Molecular Formula | C20H30FN3O5S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[4-(5-butyl-2-pyridinyl)-4-fluoropiperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | CCCCc1ccc(C2(F)CCN(S(=O)(=O)C3(C(=O)NO)CCOCC3)CC2)nc1 |
| InChI | InChI=1S/C20H30FN3O5S/c1-2-3-4-16-5-6-17(22-15-16)19(21)7-11-24(12-8-19)30(27,28)20(18(25)23-26)9-13-29-14-10-20/h5-6,15,26H,2-4,7-14H2,1H3,(H,23,25) |
| InChIKey | WVEPYQVFKRMATN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|