About tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate
tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 10343374) has the molecular formula C21H33NO7S
and a molecular weight of 443.56 g/mol. Its IUPAC name is tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
Molecular Properties
| Compound Name | tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| PubChem CID | 10343374 |
| Molecular Formula | C21H33NO7S |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(CCC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H33NO7S/c1-15-8-11-17(12-9-15)30(25,26)27-14-16(22-19(24)29-21(5,6)7)10-13-18(23)28-20(2,3)4/h8-9,11-12,16H,10,13-14H2,1-7H3,(H,22,24) |
| InChIKey | SVAOIUSLIQZGRE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate?
The IUPAC name of tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CID 10343374) is tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
What is the SMILES notation for tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate?
The canonical SMILES for tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate is Cc1ccc(S(=O)(=O)OCC(CCC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate?
The InChIKey is SVAOIUSLIQZGRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33NO7S/c1-15-8-11-17(12-9-15)30(25,26)27-14-16(22-19(24)29-21(5,6)7)10-13-18(23)28-20(2,3)4/h8-9,11-12,16H,10,13-14H2,1-7H3,(H,22,24).
What are the key properties of tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate?
tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate has a molecular weight of 443.56 g/mol, XLogP of 3.72, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-(4-methylphenyl)sulfonyloxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate is sourced from PubChem (CID 10343374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).