About 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene
1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene (PubChem CID 103434392) has the molecular formula C15H21ClO
and a molecular weight of 252.78 g/mol. Its IUPAC name is 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene |
| PubChem CID | 103434392 |
| Molecular Formula | C15H21ClO |
| Molecular Weight | 252.78 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene |
| SMILES | COc1c(CCC(Cl)C2CC2)ccc(C)c1C |
| InChI | InChI=1S/C15H21ClO/c1-10-4-5-13(15(17-3)11(10)2)8-9-14(16)12-6-7-12/h4-5,12,14H,6-9H2,1-3H3 |
| InChIKey | SNEJEUOBSNQRCC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.78 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene?
The IUPAC name of 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene (CID 103434392) is 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene.
What is the SMILES notation for 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene?
The canonical SMILES for 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene is COc1c(CCC(Cl)C2CC2)ccc(C)c1C.
What is the InChIKey of 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene?
The InChIKey is SNEJEUOBSNQRCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO/c1-10-4-5-13(15(17-3)11(10)2)8-9-14(16)12-6-7-12/h4-5,12,14H,6-9H2,1-3H3.
What are the key properties of 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene?
1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene has a molecular weight of 252.78 g/mol, XLogP of 4.26, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-3-cyclopropylpropyl)-2-methoxy-3,4-dimethylbenzene is sourced from PubChem (CID 103434392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).