C14H14FNO — CID 103434468
4-fluoro-2-(2-methoxy-3,4-dimethylphenyl)pyridine (PubChem CID 103434468) has the molecular formula C14H14FNO and a molecular weight of 231.27 g/mol. Its IUPAC name is 4-fluoro-2-(2-methoxy-3,4-dimethylphenyl)pyridine.
| Compound Name | 4-fluoro-2-(2-methoxy-3,4-dimethylphenyl)pyridine |
|---|---|
| PubChem CID | 103434468 |
| Molecular Formula | C14H14FNO |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 4-fluoro-2-(2-methoxy-3,4-dimethylphenyl)pyridine |
| SMILES | COc1c(-c2cc(F)ccn2)ccc(C)c1C |
| InChI | InChI=1S/C14H14FNO/c1-9-4-5-12(14(17-3)10(9)2)13-8-11(15)6-7-16-13/h4-8H,1-3H3 |
| InChIKey | NJICGQDIQORAAE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |