About N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide
N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide (PubChem CID 10343547) has the molecular formula C27H30N2O2S
and a molecular weight of 446.62 g/mol. Its IUPAC name is N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide |
| PubChem CID | 10343547 |
| Molecular Formula | C27H30N2O2S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2\CCCCC2(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H30N2O2S/c1-22-15-17-25(18-16-22)32(30,31)29-28-26-14-8-9-19-27(26,20-23-10-4-2-5-11-23)21-24-12-6-3-7-13-24/h2-7,10-13,15-18,29H,8-9,14,19-21H2,1H3/b28-26+ |
| InChIKey | AFUWPVCWJUFHQJ-BYCLXTJYSA-N |
| XLogP | 5.68 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide?
The IUPAC name of N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide (CID 10343547) is N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide.
What is the SMILES notation for N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide?
The canonical SMILES for N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide is Cc1ccc(S(=O)(=O)N/N=C2\CCCCC2(Cc2ccccc2)Cc2ccccc2)cc1.
What is the InChIKey of N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide?
The InChIKey is AFUWPVCWJUFHQJ-BYCLXTJYSA-N. The full InChI is InChI=1S/C27H30N2O2S/c1-22-15-17-25(18-16-22)32(30,31)29-28-26-14-8-9-19-27(26,20-23-10-4-2-5-11-23)21-24-12-6-3-7-13-24/h2-7,10-13,15-18,29H,8-9,14,19-21H2,1H3/b28-26+.
What are the key properties of N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide?
N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide has a molecular weight of 446.62 g/mol, XLogP of 5.68, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-(2,2-dibenzylcyclohexylidene)amino]-4-methylbenzenesulfonamide is sourced from PubChem (CID 10343547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).